C28H28N2O6 — CID 91808219
4-[1-(hydroxymethyl)cyclohexanecarbonyl]-5-(2-methoxyphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 91808219) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 4-[1-(hydroxymethyl)cyclohexanecarbonyl]-5-(2-methoxyphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-[1-(hydroxymethyl)cyclohexanecarbonyl]-5-(2-methoxyphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808219 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 4-[1-(hydroxymethyl)cyclohexanecarbonyl]-5-(2-methoxyphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccccc1C1C(C(=O)C2(CO)CCCCC2)C(=O)C(=O)N1c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C28H28N2O6/c1-35-22-8-4-3-7-20(22)24-23(26(33)28(17-31)14-5-2-6-15-28)25(32)27(34)30(24)19-11-9-18(10-12-19)21-13-16-36-29-21/h3-4,7-13,16,23-24,31H,2,5-6,14-15,17H2,1H3 |
| InChIKey | MKNFXMVHPGKFRD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|