C24H24N2O5S — CID 91808224
4-(2,2-dimethylpropanoyl)-1-(5-methoxy-1,3-benzothiazol-2-yl)-5-(2-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 91808224) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-1-(5-methoxy-1,3-benzothiazol-2-yl)-5-(2-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(2,2-dimethylpropanoyl)-1-(5-methoxy-1,3-benzothiazol-2-yl)-5-(2-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808224 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-1-(5-methoxy-1,3-benzothiazol-2-yl)-5-(2-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2sc(N3C(=O)C(=O)C(C(=O)C(C)(C)C)C3c3ccccc3OC)nc2c1 |
| InChI | InChI=1S/C24H24N2O5S/c1-24(2,3)21(28)18-19(14-8-6-7-9-16(14)31-5)26(22(29)20(18)27)23-25-15-12-13(30-4)10-11-17(15)32-23/h6-12,18-19H,1-5H3 |
| InChIKey | YNAIYBFLAHWADJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|