C24H27NO5S — CID 91808247
4-(2,2-dimethylpropanoyl)-5-[2-(2-hydroxyethoxy)phenyl]-1-(4-methylsulfanylphenyl)pyrrolidine-2,3-dione (PubChem CID 91808247) has the molecular formula C24H27NO5S and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-5-[2-(2-hydroxyethoxy)phenyl]-1-(4-methylsulfanylphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(2,2-dimethylpropanoyl)-5-[2-(2-hydroxyethoxy)phenyl]-1-(4-methylsulfanylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808247 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-5-[2-(2-hydroxyethoxy)phenyl]-1-(4-methylsulfanylphenyl)pyrrolidine-2,3-dione |
| SMILES | CSc1ccc(N2C(=O)C(=O)C(C(=O)C(C)(C)C)C2c2ccccc2OCCO)cc1 |
| InChI | InChI=1S/C24H27NO5S/c1-24(2,3)22(28)19-20(17-7-5-6-8-18(17)30-14-13-26)25(23(29)21(19)27)15-9-11-16(31-4)12-10-15/h5-12,19-20,26H,13-14H2,1-4H3 |
| InChIKey | SUFJDWJGTMFJTQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|