C27H27NO6 — CID 91808249
4-(2,2-dimethylpropanoyl)-1-[4-(furan-2-yl)phenyl]-5-[2-(2-hydroxyethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 91808249) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-1-[4-(furan-2-yl)phenyl]-5-[2-(2-hydroxyethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-(2,2-dimethylpropanoyl)-1-[4-(furan-2-yl)phenyl]-5-[2-(2-hydroxyethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808249 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-1-[4-(furan-2-yl)phenyl]-5-[2-(2-hydroxyethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | CC(C)(C)C(=O)C1C(=O)C(=O)N(c2ccc(-c3ccco3)cc2)C1c1ccccc1OCCO |
| InChI | InChI=1S/C27H27NO6/c1-27(2,3)25(31)22-23(19-7-4-5-8-21(19)34-16-14-29)28(26(32)24(22)30)18-12-10-17(11-13-18)20-9-6-15-33-20/h4-13,15,22-23,29H,14,16H2,1-3H3 |
| InChIKey | SKEXRBMITBEXBW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|