C27H25NO6S — CID 91808269
2-[2-[3-(2,2-dimethylpropanoyl)-4,5-dioxo-1-(4-thiophen-3-ylphenyl)pyrrolidin-2-yl]phenoxy]acetic acid (PubChem CID 91808269) has the molecular formula C27H25NO6S and a molecular weight of 491.57 g/mol. Its IUPAC name is 2-[2-[3-(2,2-dimethylpropanoyl)-4,5-dioxo-1-(4-thiophen-3-ylphenyl)pyrrolidin-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[3-(2,2-dimethylpropanoyl)-4,5-dioxo-1-(4-thiophen-3-ylphenyl)pyrrolidin-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 91808269 |
| Molecular Formula | C27H25NO6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2-[2-[3-(2,2-dimethylpropanoyl)-4,5-dioxo-1-(4-thiophen-3-ylphenyl)pyrrolidin-2-yl]phenoxy]acetic acid |
| SMILES | CC(C)(C)C(=O)C1C(=O)C(=O)N(c2ccc(-c3ccsc3)cc2)C1c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C27H25NO6S/c1-27(2,3)25(32)22-23(19-6-4-5-7-20(19)34-14-21(29)30)28(26(33)24(22)31)18-10-8-16(9-11-18)17-12-13-35-15-17/h4-13,15,22-23H,14H2,1-3H3,(H,29,30) |
| InChIKey | CPKFYCNPRLIMOP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|