C26H26N2O6 — CID 91808309
4-(2,2-dimethylpropanoyl)-1-[4-(furan-3-yl)phenyl]-5-[2-(2-hydroxyethoxy)-3-pyridinyl]pyrrolidine-2,3-dione (PubChem CID 91808309) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-1-[4-(furan-3-yl)phenyl]-5-[2-(2-hydroxyethoxy)-3-pyridinyl]pyrrolidine-2,3-dione.
| Compound Name | 4-(2,2-dimethylpropanoyl)-1-[4-(furan-3-yl)phenyl]-5-[2-(2-hydroxyethoxy)-3-pyridinyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808309 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-1-[4-(furan-3-yl)phenyl]-5-[2-(2-hydroxyethoxy)-3-pyridinyl]pyrrolidine-2,3-dione |
| SMILES | CC(C)(C)C(=O)C1C(=O)C(=O)N(c2ccc(-c3ccoc3)cc2)C1c1cccnc1OCCO |
| InChI | InChI=1S/C26H26N2O6/c1-26(2,3)23(31)20-21(19-5-4-11-27-24(19)34-14-12-29)28(25(32)22(20)30)18-8-6-16(7-9-18)17-10-13-33-15-17/h4-11,13,15,20-21,29H,12,14H2,1-3H3 |
| InChIKey | PTIQLLBJGHECCZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|