C25H25N3O5 — CID 91808438
5-[2-(methoxymethyl)phenyl]-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-(2-methylpropanoyl)pyrrolidine-2,3-dione (PubChem CID 91808438) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 5-[2-(methoxymethyl)phenyl]-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-(2-methylpropanoyl)pyrrolidine-2,3-dione.
| Compound Name | 5-[2-(methoxymethyl)phenyl]-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-(2-methylpropanoyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808438 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 5-[2-(methoxymethyl)phenyl]-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-(2-methylpropanoyl)pyrrolidine-2,3-dione |
| SMILES | COCc1ccccc1C1C(C(=O)C(C)C)C(=O)C(=O)N1c1ccc(-c2noc(C)n2)cc1 |
| InChI | InChI=1S/C25H25N3O5/c1-14(2)22(29)20-21(19-8-6-5-7-17(19)13-32-4)28(25(31)23(20)30)18-11-9-16(10-12-18)24-26-15(3)33-27-24/h5-12,14,20-21H,13H2,1-4H3 |
| InChIKey | ZCAWJZZMAJUESN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|