C28H30N2O5S — CID 91808576
4-(3,3-dimethylbutanoyl)-5-[2-(2-methoxyethoxy)-3-pyridinyl]-1-(4-thiophen-3-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 91808576) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is 4-(3,3-dimethylbutanoyl)-5-[2-(2-methoxyethoxy)-3-pyridinyl]-1-(4-thiophen-3-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(3,3-dimethylbutanoyl)-5-[2-(2-methoxyethoxy)-3-pyridinyl]-1-(4-thiophen-3-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808576 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 4-(3,3-dimethylbutanoyl)-5-[2-(2-methoxyethoxy)-3-pyridinyl]-1-(4-thiophen-3-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | COCCOc1ncccc1C1C(C(=O)CC(C)(C)C)C(=O)C(=O)N1c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C28H30N2O5S/c1-28(2,3)16-22(31)23-24(21-6-5-12-29-26(21)35-14-13-34-4)30(27(33)25(23)32)20-9-7-18(8-10-20)19-11-15-36-17-19/h5-12,15,17,23-24H,13-14,16H2,1-4H3 |
| InChIKey | GGEJOOVCJBQBPQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|