C29H30N2O5 — CID 91808606
N,N-dimethyl-2-[2-[1-[4-(5-methylfuran-2-yl)phenyl]-3-(2-methylpropanoyl)-4,5-dioxopyrrolidin-2-yl]phenyl]acetamide (PubChem CID 91808606) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-[1-[4-(5-methylfuran-2-yl)phenyl]-3-(2-methylpropanoyl)-4,5-dioxopyrrolidin-2-yl]phenyl]acetamide.
| Compound Name | N,N-dimethyl-2-[2-[1-[4-(5-methylfuran-2-yl)phenyl]-3-(2-methylpropanoyl)-4,5-dioxopyrrolidin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 91808606 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | N,N-dimethyl-2-[2-[1-[4-(5-methylfuran-2-yl)phenyl]-3-(2-methylpropanoyl)-4,5-dioxopyrrolidin-2-yl]phenyl]acetamide |
| SMILES | Cc1ccc(-c2ccc(N3C(=O)C(=O)C(C(=O)C(C)C)C3c3ccccc3CC(=O)N(C)C)cc2)o1 |
| InChI | InChI=1S/C29H30N2O5/c1-17(2)27(33)25-26(22-9-7-6-8-20(22)16-24(32)30(4)5)31(29(35)28(25)34)21-13-11-19(12-14-21)23-15-10-18(3)36-23/h6-15,17,25-26H,16H2,1-5H3 |
| InChIKey | XKPPCNRXBMEQOW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|