C29H31N3O5 — CID 91808632
4-(cyclopentanecarbonyl)-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[2-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 91808632) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is 4-(cyclopentanecarbonyl)-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[2-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-(cyclopentanecarbonyl)-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[2-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808632 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 4-(cyclopentanecarbonyl)-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[2-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | Cc1nc(-c2ccc(N3C(=O)C(=O)C(C(=O)C4CCCC4)C3c3ccccc3OCC(C)C)cc2)no1 |
| InChI | InChI=1S/C29H31N3O5/c1-17(2)16-36-23-11-7-6-10-22(23)25-24(26(33)19-8-4-5-9-19)27(34)29(35)32(25)21-14-12-20(13-15-21)28-30-18(3)37-31-28/h6-7,10-15,17,19,24-25H,4-5,8-9,16H2,1-3H3 |
| InChIKey | YMQRKYQPAORLQK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|