C30H32N2O5 — CID 91808646
N,N-dimethyl-3-[2-[1-[4-(5-methylfuran-2-yl)phenyl]-3-(2-methylpropanoyl)-4,5-dioxopyrrolidin-2-yl]phenyl]propanamide (PubChem CID 91808646) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[1-[4-(5-methylfuran-2-yl)phenyl]-3-(2-methylpropanoyl)-4,5-dioxopyrrolidin-2-yl]phenyl]propanamide.
| Compound Name | N,N-dimethyl-3-[2-[1-[4-(5-methylfuran-2-yl)phenyl]-3-(2-methylpropanoyl)-4,5-dioxopyrrolidin-2-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 91808646 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N,N-dimethyl-3-[2-[1-[4-(5-methylfuran-2-yl)phenyl]-3-(2-methylpropanoyl)-4,5-dioxopyrrolidin-2-yl]phenyl]propanamide |
| SMILES | Cc1ccc(-c2ccc(N3C(=O)C(=O)C(C(=O)C(C)C)C3c3ccccc3CCC(=O)N(C)C)cc2)o1 |
| InChI | InChI=1S/C30H32N2O5/c1-18(2)28(34)26-27(23-9-7-6-8-20(23)13-17-25(33)31(4)5)32(30(36)29(26)35)22-14-11-21(12-15-22)24-16-10-19(3)37-24/h6-12,14-16,18,26-27H,13,17H2,1-5H3 |
| InChIKey | RSGUGMKSZPUJSI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|