C27H29N3O5 — CID 91808661
1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-4-(2-methylpropanoyl)-5-[2-(propan-2-yloxymethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 91808661) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-4-(2-methylpropanoyl)-5-[2-(propan-2-yloxymethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-4-(2-methylpropanoyl)-5-[2-(propan-2-yloxymethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808661 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-4-(2-methylpropanoyl)-5-[2-(propan-2-yloxymethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | Cc1noc(-c2ccc(N3C(=O)C(=O)C(C(=O)C(C)C)C3c3ccccc3COC(C)C)cc2)n1 |
| InChI | InChI=1S/C27H29N3O5/c1-15(2)24(31)22-23(21-9-7-6-8-19(21)14-34-16(3)4)30(27(33)25(22)32)20-12-10-18(11-13-20)26-28-17(5)29-35-26/h6-13,15-16,22-23H,14H2,1-5H3 |
| InChIKey | KFSJFGNSRGVBME-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|