C34H33FN8O4 — CID 91809324
N-benzyl-4-[[4-[2-[2-[(4-fluorobenzoyl)amino]ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 91809324) has the molecular formula C34H33FN8O4 and a molecular weight of 636.69 g/mol. Its IUPAC name is N-benzyl-4-[[4-[2-[2-[(4-fluorobenzoyl)amino]ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-benzyl-4-[[4-[2-[2-[(4-fluorobenzoyl)amino]ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 91809324 |
| Molecular Formula | C34H33FN8O4 |
| Molecular Weight | 636.69 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | N-benzyl-4-[[4-[2-[2-[(4-fluorobenzoyl)amino]ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | O=C(NCCOCCNc1nc(Nc2ccc(O)cc2)nc(Nc2ccc(C(=O)NCc3ccccc3)cc2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C34H33FN8O4/c35-26-10-6-24(7-11-26)30(45)36-18-20-47-21-19-37-32-41-33(43-34(42-32)40-28-14-16-29(44)17-15-28)39-27-12-8-25(9-13-27)31(46)38-22-23-4-2-1-3-5-23/h1-17,44H,18-22H2,(H,36,45)(H,38,46)(H3,37,39,40,41,42,43) |
| InChIKey | NERDMWOUEPMVPG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|