C9H15NO5 — CID 91810431
N-[(3S,4R,5S,6S)-4,5-dihydroxy-6-[(2S)-oxiran-2-yl]oxan-3-yl]acetamide (PubChem CID 91810431) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is N-[(3S,4R,5S,6S)-4,5-dihydroxy-6-[(2S)-oxiran-2-yl]oxan-3-yl]acetamide.
| Compound Name | N-[(3S,4R,5S,6S)-4,5-dihydroxy-6-[(2S)-oxiran-2-yl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 91810431 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | N-[(3S,4R,5S,6S)-4,5-dihydroxy-6-[(2S)-oxiran-2-yl]oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CO[C@H]([C@@H]2CO2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H15NO5/c1-4(11)10-5-2-15-9(6-3-14-6)8(13)7(5)12/h5-9,12-13H,2-3H2,1H3,(H,10,11)/t5-,6-,7+,8-,9+/m0/s1 |
| InChIKey | DDNYYKVSFZCXNL-VRGHQRLXSA-N |
| XLogP | -1.99 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|