About Kdoam-25
Kdoam-25 (PubChem CID 91810435) has the molecular formula C15H25N5O2
and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | Kdoam-25 |
| PubChem CID | 91810435 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxamide |
| SMILES | CCN(CCN(C)C)C(=O)CNCC1=NC=CC(=C1)C(=O)N |
| InChI | InChI=1S/C15H25N5O2/c1-4-20(8-7-19(2)3)14(21)11-17-10-13-9-12(15(16)22)5-6-18-13/h5-6,9,17H,4,7-8,10-11H2,1-3H3,(H2,16,22) |
| InChIKey | PNFMVADNCOGWME-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | 362 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Kdoam-25 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Kdoam-25?
The IUPAC name of Kdoam-25 (CID 91810435) is 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxamide.
What is the SMILES notation for Kdoam-25?
The canonical SMILES for Kdoam-25 is CCN(CCN(C)C)C(=O)CNCC1=NC=CC(=C1)C(=O)N.
What is the InChIKey of Kdoam-25?
The InChIKey is PNFMVADNCOGWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5O2/c1-4-20(8-7-19(2)3)14(21)11-17-10-13-9-12(15(16)22)5-6-18-13/h5-6,9,17H,4,7-8,10-11H2,1-3H3,(H2,16,22).
What are the key properties of Kdoam-25?
Kdoam-25 has a molecular weight of 307.39 g/mol, XLogP of -0.90, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Kdoam-25 is sourced from PubChem (CID 91810435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).