C19H15N4O4S- — CID 9181049
2-[[5-(2-methylfuran-3-yl)-4-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 9181049) has the molecular formula C19H15N4O4S- and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[[5-(2-methylfuran-3-yl)-4-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[5-(2-methylfuran-3-yl)-4-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 9181049 |
| Molecular Formula | C19H15N4O4S- |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-[[5-(2-methylfuran-3-yl)-4-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | C#CCOc1ccccc1/C=N\n1c(SCC(=O)[O-])nnc1-c1ccoc1C |
| InChI | InChI=1S/C19H16N4O4S/c1-3-9-27-16-7-5-4-6-14(16)11-20-23-18(15-8-10-26-13(15)2)21-22-19(23)28-12-17(24)25/h1,4-8,10-11H,9,12H2,2H3,(H,24,25)/p-1/b20-11- |
| InChIKey | SNZSVKKQXFBSFN-JAIQZWGSSA-M |
| XLogP | 1.58 |
| TPSA | 105.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|