C24H23NO10 — CID 91810533
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-[4-(4-hydroxyphenyl)-5-phenyl-1,3-oxazol-2-yl]propanoyloxy]oxane-2-carboxylic acid (PubChem CID 91810533) has the molecular formula C24H23NO10 and a molecular weight of 485.45 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-[4-(4-hydroxyphenyl)-5-phenyl-1,3-oxazol-2-yl]propanoyloxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-[4-(4-hydroxyphenyl)-5-phenyl-1,3-oxazol-2-yl]propanoyloxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91810533 |
| Molecular Formula | C24H23NO10 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-[4-(4-hydroxyphenyl)-5-phenyl-1,3-oxazol-2-yl]propanoyloxy]oxane-2-carboxylic acid |
| SMILES | O=C(CCc1nc(-c2ccc(O)cc2)c(-c2ccccc2)o1)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H23NO10/c26-14-8-6-12(7-9-14)17-21(13-4-2-1-3-5-13)33-15(25-17)10-11-16(27)34-24-20(30)18(28)19(29)22(35-24)23(31)32/h1-9,18-20,22,24,26,28-30H,10-11H2,(H,31,32)/t18-,19-,20+,22-,24+/m0/s1 |
| InChIKey | GQCBWWAUYHUJOD-MJRVOHGCSA-N |
| XLogP | 1.08 |
| TPSA | 179.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |