C8H14FNO2 — CID 91810852
(6R,7R,8S)-8-(fluoromethyl)-4-azaspiro[2.5]octane-6,7-diol (PubChem CID 91810852) has the molecular formula C8H14FNO2 and a molecular weight of 175.20 g/mol. Its IUPAC name is (6R,7R,8S)-8-(fluoromethyl)-4-azaspiro[2.5]octane-6,7-diol.
| Compound Name | (6R,7R,8S)-8-(fluoromethyl)-4-azaspiro[2.5]octane-6,7-diol |
|---|---|
| PubChem CID | 91810852 |
| Molecular Formula | C8H14FNO2 |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (6R,7R,8S)-8-(fluoromethyl)-4-azaspiro[2.5]octane-6,7-diol |
| SMILES | O[C@H]1[C@H](O)CNC2(CC2)[C@@H]1CF |
| InChI | InChI=1S/C8H14FNO2/c9-3-5-7(12)6(11)4-10-8(5)1-2-8/h5-7,10-12H,1-4H2/t5-,6-,7-/m1/s1 |
| InChIKey | MFUFEXHORIKDTD-FSDSQADBSA-N |
| XLogP | -0.57 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |