About 4,6,7-trichloro-3H-1,3-benzothiazol-2-one
4,6,7-trichloro-3H-1,3-benzothiazol-2-one (PubChem CID 91810908) has the molecular formula C7H2Cl3NOS
and a molecular weight of 254.53 g/mol. Its IUPAC name is 4,6,7-trichloro-3H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 4,6,7-trichloro-3H-1,3-benzothiazol-2-one |
| PubChem CID | 91810908 |
| Molecular Formula | C7H2Cl3NOS |
| Molecular Weight | 254.53 g/mol |
| Exact Mass | 252.89 |
| IUPAC Name | 4,6,7-trichloro-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(Cl)cc(Cl)c(Cl)c2s1 |
| InChI | InChI=1S/C7H2Cl3NOS/c8-2-1-3(9)5-6(4(2)10)13-7(12)11-5/h1H,(H,11,12) |
| InChIKey | SDMDWUGHXHPRHI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4,6,7-trichloro-3H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6,7-trichloro-3H-1,3-benzothiazol-2-one?
The IUPAC name of 4,6,7-trichloro-3H-1,3-benzothiazol-2-one (CID 91810908) is 4,6,7-trichloro-3H-1,3-benzothiazol-2-one.
What is the SMILES notation for 4,6,7-trichloro-3H-1,3-benzothiazol-2-one?
The canonical SMILES for 4,6,7-trichloro-3H-1,3-benzothiazol-2-one is O=c1[nH]c2c(Cl)cc(Cl)c(Cl)c2s1.
What is the InChIKey of 4,6,7-trichloro-3H-1,3-benzothiazol-2-one?
The InChIKey is SDMDWUGHXHPRHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl3NOS/c8-2-1-3(9)5-6(4(2)10)13-7(12)11-5/h1H,(H,11,12).
What are the key properties of 4,6,7-trichloro-3H-1,3-benzothiazol-2-one?
4,6,7-trichloro-3H-1,3-benzothiazol-2-one has a molecular weight of 254.53 g/mol, XLogP of 3.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6,7-trichloro-3H-1,3-benzothiazol-2-one is sourced from PubChem (CID 91810908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).