C18H24ClN3O3 — CID 9181207
4-(4-acetylpiperazin-1-yl)-N-[(1S)-1-(3-chlorophenyl)ethyl]-4-oxobutanamide (PubChem CID 9181207) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-[(1S)-1-(3-chlorophenyl)ethyl]-4-oxobutanamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-[(1S)-1-(3-chlorophenyl)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 9181207 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-[(1S)-1-(3-chlorophenyl)ethyl]-4-oxobutanamide |
| SMILES | CC(=O)N1CCN(C(=O)CCC(=O)N[C@@H](C)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H24ClN3O3/c1-13(15-4-3-5-16(19)12-15)20-17(24)6-7-18(25)22-10-8-21(9-11-22)14(2)23/h3-5,12-13H,6-11H2,1-2H3,(H,20,24)/t13-/m0/s1 |
| InChIKey | ULZHADYYQBLFEM-ZDUSSCGKSA-N |
| XLogP | 1.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |