C19H24N4O2S — CID 91812091
tert-butyl 2-(6-thiophen-2-ylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 91812091) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is tert-butyl 2-(6-thiophen-2-ylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-(6-thiophen-2-ylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 91812091 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | tert-butyl 2-(6-thiophen-2-ylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(c3ccc(-c4cccs4)nn3)CC2C1 |
| InChI | InChI=1S/C19H24N4O2S/c1-19(2,3)25-18(24)23-11-13-9-22(10-14(13)12-23)17-7-6-15(20-21-17)16-5-4-8-26-16/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | NONXNDKPEZIEAZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |