About tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate
tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate (PubChem CID 91812188) has the molecular formula C19H32N2O4
and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate |
| PubChem CID | 91812188 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC1(C2)CN(C(C)(C)C)C(=O)CO1 |
| InChI | InChI=1S/C19H32N2O4/c1-17(2,3)20-12-19(24-11-15(20)22)9-13-7-8-14(10-19)21(13)16(23)25-18(4,5)6/h13-14H,7-12H2,1-6H3 |
| InChIKey | BUYPZQFJYHUTGT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate?
The IUPAC name of tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate (CID 91812188) is tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate.
What is the SMILES notation for tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate?
The canonical SMILES for tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate is CC(C)(C)OC(=O)N1C2CCC1CC1(C2)CN(C(C)(C)C)C(=O)CO1.
What is the InChIKey of tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate?
The InChIKey is BUYPZQFJYHUTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O4/c1-17(2,3)20-12-19(24-11-15(20)22)9-13-7-8-14(10-19)21(13)16(23)25-18(4,5)6/h13-14H,7-12H2,1-6H3.
What are the key properties of tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate?
tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate has a molecular weight of 352.48 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4'-tert-butyl-5'-oxospiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate is sourced from PubChem (CID 91812188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).