About 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride
4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride (PubChem CID 91812251) has the molecular formula C11H19ClN2O2
and a molecular weight of 246.74 g/mol. Its IUPAC name is 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride.
Molecular Properties
| Compound Name | 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride |
| PubChem CID | 91812251 |
| Molecular Formula | C11H19ClN2O2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride |
| SMILES | CN1CC2(CC3CCC(C2)N3)OCC1=O.Cl |
| InChI | InChI=1S/C11H18N2O2.ClH/c1-13-7-11(15-6-10(13)14)4-8-2-3-9(5-11)12-8;/h8-9,12H,2-7H2,1H3;1H |
| InChIKey | IRDWZEOMQMPWBU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride?
The IUPAC name of 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride (CID 91812251) is 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride.
What is the SMILES notation for 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride?
The canonical SMILES for 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride is CN1CC2(CC3CCC(C2)N3)OCC1=O.Cl.
What is the InChIKey of 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride?
The InChIKey is IRDWZEOMQMPWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2.ClH/c1-13-7-11(15-6-10(13)14)4-8-2-3-9(5-11)12-8;/h8-9,12H,2-7H2,1H3;1H.
What are the key properties of 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride?
4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride has a molecular weight of 246.74 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-methylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride is sourced from PubChem (CID 91812251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).