About 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride
4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride (PubChem CID 91812255) has the molecular formula C13H21ClN2O2
and a molecular weight of 272.78 g/mol. Its IUPAC name is 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride.
Molecular Properties
| Compound Name | 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride |
| PubChem CID | 91812255 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride |
| SMILES | Cl.O=C1COC2(CC3CCC(C2)N3)CN1C1CC1 |
| InChI | InChI=1S/C13H20N2O2.ClH/c16-12-7-17-13(8-15(12)11-3-4-11)5-9-1-2-10(6-13)14-9;/h9-11,14H,1-8H2;1H |
| InChIKey | BTWHTDNZZSRIBY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride?
The IUPAC name of 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride (CID 91812255) is 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride.
What is the SMILES notation for 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride?
The canonical SMILES for 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride is Cl.O=C1COC2(CC3CCC(C2)N3)CN1C1CC1.
What is the InChIKey of 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride?
The InChIKey is BTWHTDNZZSRIBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2.ClH/c16-12-7-17-13(8-15(12)11-3-4-11)5-9-1-2-10(6-13)14-9;/h9-11,14H,1-8H2;1H.
What are the key properties of 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride?
4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride has a molecular weight of 272.78 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-cyclopropylspiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one;hydrochloride is sourced from PubChem (CID 91812255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).