About 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride
4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride (PubChem CID 91812264) has the molecular formula C14H27ClN2O
and a molecular weight of 274.84 g/mol. Its IUPAC name is 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride.
Molecular Properties
| Compound Name | 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride |
| PubChem CID | 91812264 |
| Molecular Formula | C14H27ClN2O |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride |
| SMILES | CC(C)(C)N1CCOC2(CC3CCC(C2)N3)C1.Cl |
| InChI | InChI=1S/C14H26N2O.ClH/c1-13(2,3)16-6-7-17-14(10-16)8-11-4-5-12(9-14)15-11;/h11-12,15H,4-10H2,1-3H3;1H |
| InChIKey | OAYGGUZTQMKXBZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride?
The IUPAC name of 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride (CID 91812264) is 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride.
What is the SMILES notation for 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride?
The canonical SMILES for 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride is CC(C)(C)N1CCOC2(CC3CCC(C2)N3)C1.Cl.
What is the InChIKey of 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride?
The InChIKey is OAYGGUZTQMKXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O.ClH/c1-13(2,3)16-6-7-17-14(10-16)8-11-4-5-12(9-14)15-11;/h11-12,15H,4-10H2,1-3H3;1H.
What are the key properties of 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride?
4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride has a molecular weight of 274.84 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-tert-butylspiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine];hydrochloride is sourced from PubChem (CID 91812264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).