C5H6F3N3O2S2 — CID 91812350
2-amino-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 91812350) has the molecular formula C5H6F3N3O2S2 and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-amino-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 91812350 |
| Molecular Formula | C5H6F3N3O2S2 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 2-amino-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Nc1ncc(S(=O)(=O)NCC(F)(F)F)s1 |
| InChI | InChI=1S/C5H6F3N3O2S2/c6-5(7,8)2-11-15(12,13)3-1-10-4(9)14-3/h1,11H,2H2,(H2,9,10) |
| InChIKey | UFWJRKPYEUCGGP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |