About N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine
N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine (PubChem CID 91812382) has the molecular formula C10H18N4O2S
and a molecular weight of 258.35 g/mol. Its IUPAC name is N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine.
Molecular Properties
| Compound Name | N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine |
| PubChem CID | 91812382 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine |
| SMILES | CNC1CN(S(=O)(=O)c2c(C)nn(C)c2C)C1 |
| InChI | InChI=1S/C10H18N4O2S/c1-7-10(8(2)13(4)12-7)17(15,16)14-5-9(6-14)11-3/h9,11H,5-6H2,1-4H3 |
| InChIKey | ZEUSSLZLZUAGEU-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine?
The IUPAC name of N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine (CID 91812382) is N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine.
What is the SMILES notation for N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine?
The canonical SMILES for N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine is CNC1CN(S(=O)(=O)c2c(C)nn(C)c2C)C1.
What is the InChIKey of N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine?
The InChIKey is ZEUSSLZLZUAGEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2S/c1-7-10(8(2)13(4)12-7)17(15,16)14-5-9(6-14)11-3/h9,11H,5-6H2,1-4H3.
What are the key properties of N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine?
N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine has a molecular weight of 258.35 g/mol, XLogP of -0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazetidin-3-amine is sourced from PubChem (CID 91812382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).