About 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one
4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 91812682) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 91812682 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN(C)c1ncnc2c1ccc(=O)n2C |
| InChI | InChI=1S/C10H12N4O/c1-13(2)9-7-4-5-8(15)14(3)10(7)12-6-11-9/h4-6H,1-3H3 |
| InChIKey | KURLZIMJCYXISN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one (CID 91812682) is 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one is CN(C)c1ncnc2c1ccc(=O)n2C.
What is the InChIKey of 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The InChIKey is KURLZIMJCYXISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-13(2)9-7-4-5-8(15)14(3)10(7)12-6-11-9/h4-6H,1-3H3.
What are the key properties of 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one?
4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one has a molecular weight of 204.23 g/mol, XLogP of 0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 91812682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).