C14H16N2O2S — CID 91813695
N-butyl-4-(1,3-thiazol-2-yloxy)benzamide (PubChem CID 91813695) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-butyl-4-(1,3-thiazol-2-yloxy)benzamide.
| Compound Name | N-butyl-4-(1,3-thiazol-2-yloxy)benzamide |
|---|---|
| PubChem CID | 91813695 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-butyl-4-(1,3-thiazol-2-yloxy)benzamide |
| SMILES | CCCCNC(=O)c1ccc(Oc2nccs2)cc1 |
| InChI | InChI=1S/C14H16N2O2S/c1-2-3-8-15-13(17)11-4-6-12(7-5-11)18-14-16-9-10-19-14/h4-7,9-10H,2-3,8H2,1H3,(H,15,17) |
| InChIKey | GPZKQMXUANUGEK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|