C19H24FN5O — CID 91814088
3-(dimethylamino)-N-[[1-(5-fluoropyrimidin-2-yl)piperidin-4-yl]methyl]benzamide (PubChem CID 91814088) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[[1-(5-fluoropyrimidin-2-yl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[[1-(5-fluoropyrimidin-2-yl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91814088 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 3-(dimethylamino)-N-[[1-(5-fluoropyrimidin-2-yl)piperidin-4-yl]methyl]benzamide |
| SMILES | CN(C)c1cccc(C(=O)NCC2CCN(c3ncc(F)cn3)CC2)c1 |
| InChI | InChI=1S/C19H24FN5O/c1-24(2)17-5-3-4-15(10-17)18(26)21-11-14-6-8-25(9-7-14)19-22-12-16(20)13-23-19/h3-5,10,12-14H,6-9,11H2,1-2H3,(H,21,26) |
| InChIKey | IXNKBVPUPNDGBN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |