C20H30N2O5S2 — CID 91814290
methyl 4-methoxy-3-[[1-(thian-4-yl)piperidin-4-yl]methylsulfamoyl]benzoate (PubChem CID 91814290) has the molecular formula C20H30N2O5S2 and a molecular weight of 442.60 g/mol. Its IUPAC name is methyl 4-methoxy-3-[[1-(thian-4-yl)piperidin-4-yl]methylsulfamoyl]benzoate.
| Compound Name | methyl 4-methoxy-3-[[1-(thian-4-yl)piperidin-4-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 91814290 |
| Molecular Formula | C20H30N2O5S2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | methyl 4-methoxy-3-[[1-(thian-4-yl)piperidin-4-yl]methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(OC)c(S(=O)(=O)NCC2CCN(C3CCSCC3)CC2)c1 |
| InChI | InChI=1S/C20H30N2O5S2/c1-26-18-4-3-16(20(23)27-2)13-19(18)29(24,25)21-14-15-5-9-22(10-6-15)17-7-11-28-12-8-17/h3-4,13,15,17,21H,5-12,14H2,1-2H3 |
| InChIKey | DRAZUXULNPMEMY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |