C19H27N3O2S — CID 91814292
N'-phenyl-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]oxamide (PubChem CID 91814292) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N'-phenyl-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-phenyl-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 91814292 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N'-phenyl-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]oxamide |
| SMILES | O=C(NCC1CCN(C2CCSCC2)CC1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H27N3O2S/c23-18(19(24)21-16-4-2-1-3-5-16)20-14-15-6-10-22(11-7-15)17-8-12-25-13-9-17/h1-5,15,17H,6-14H2,(H,20,23)(H,21,24) |
| InChIKey | XZQQWTLPBAFUEA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|