C14H20N2O3 — CID 91815390
N,N-dimethyl-6-(oxan-4-ylmethoxy)pyridine-3-carboxamide (PubChem CID 91815390) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N,N-dimethyl-6-(oxan-4-ylmethoxy)pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-6-(oxan-4-ylmethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91815390 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N,N-dimethyl-6-(oxan-4-ylmethoxy)pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(OCC2CCOCC2)nc1 |
| InChI | InChI=1S/C14H20N2O3/c1-16(2)14(17)12-3-4-13(15-9-12)19-10-11-5-7-18-8-6-11/h3-4,9,11H,5-8,10H2,1-2H3 |
| InChIKey | YLZVBJWYEIWOET-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |