C17H22N4O2S — CID 91816536
4-ethyl-3-[[1-[(Z)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]methyl]-1H-1,2,4-triazol-5-one (PubChem CID 91816536) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 4-ethyl-3-[[1-[(Z)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]methyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-ethyl-3-[[1-[(Z)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]methyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 91816536 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-ethyl-3-[[1-[(Z)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]methyl]-1H-1,2,4-triazol-5-one |
| SMILES | CCn1c(CC2CCCN(C(=O)/C=C\c3cccs3)C2)n[nH]c1=O |
| InChI | InChI=1S/C17H22N4O2S/c1-2-21-15(18-19-17(21)23)11-13-5-3-9-20(12-13)16(22)8-7-14-6-4-10-24-14/h4,6-8,10,13H,2-3,5,9,11-12H2,1H3,(H,19,23)/b8-7- |
| InChIKey | BFXZEUWPMXZMDS-FPLPWBNLSA-N |
| XLogP | 2.15 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|