C20H17F3N4O3 — CID 91817838
2-[4-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazine-1-carbonyl]chromen-4-one (PubChem CID 91817838) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-[4-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazine-1-carbonyl]chromen-4-one.
| Compound Name | 2-[4-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazine-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 91817838 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-[4-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazine-1-carbonyl]chromen-4-one |
| SMILES | Cc1nc(N2CCN(C(=O)c3cc(=O)c4ccccc4o3)CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H17F3N4O3/c1-12-24-17(20(21,22)23)11-18(25-12)26-6-8-27(9-7-26)19(29)16-10-14(28)13-4-2-3-5-15(13)30-16/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | AYTRYYLMCYQOCB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |