C21H23N5OS — CID 91817895
(E)-1-[4-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 91817895) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is (E)-1-[4-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 91817895 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (E)-1-[4-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)N1CCN(c2nccn3nc4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C21H23N5OS/c27-19(8-7-16-4-3-15-28-16)24-11-13-25(14-12-24)21-20-17-5-1-2-6-18(17)23-26(20)10-9-22-21/h3-4,7-10,15H,1-2,5-6,11-14H2/b8-7+ |
| InChIKey | WHFVNAHSXZMEIT-BQYQJAHWSA-N |
| XLogP | 3.03 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|