About N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide
N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide (PubChem CID 9181814) has the molecular formula C16H17FN2O
and a molecular weight of 272.32 g/mol. Its IUPAC name is N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide.
Molecular Properties
| Compound Name | N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide |
| PubChem CID | 9181814 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide |
| SMILES | CCN(NC(=O)c1ccc(F)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17FN2O/c1-3-19(15-10-4-12(2)5-11-15)18-16(20)13-6-8-14(17)9-7-13/h4-11H,3H2,1-2H3,(H,18,20) |
| InChIKey | CCDDLBPQDYJXBK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide?
The IUPAC name of N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide (CID 9181814) is N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide.
What is the SMILES notation for N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide?
The canonical SMILES for N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide is CCN(NC(=O)c1ccc(F)cc1)c1ccc(C)cc1.
What is the InChIKey of N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide?
The InChIKey is CCDDLBPQDYJXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O/c1-3-19(15-10-4-12(2)5-11-15)18-16(20)13-6-8-14(17)9-7-13/h4-11H,3H2,1-2H3,(H,18,20).
What are the key properties of N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide?
N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide has a molecular weight of 272.32 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-4-fluoro-N'-(4-methylphenyl)benzohydrazide is sourced from PubChem (CID 9181814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).