C19H14FN5O2S — CID 91818344
13-fluoro-5-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one (PubChem CID 91818344) has the molecular formula C19H14FN5O2S and a molecular weight of 395.42 g/mol. Its IUPAC name is 13-fluoro-5-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one.
| Compound Name | 13-fluoro-5-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 91818344 |
| Molecular Formula | C19H14FN5O2S |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 13-fluoro-5-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
| SMILES | O=C(c1cc(-c2cccs2)[nH]n1)N1CCc2nc3ccc(F)cn3c(=O)c2C1 |
| InChI | InChI=1S/C19H14FN5O2S/c20-11-3-4-17-21-13-5-6-24(10-12(13)18(26)25(17)9-11)19(27)15-8-14(22-23-15)16-2-1-7-28-16/h1-4,7-9H,5-6,10H2,(H,22,23) |
| InChIKey | WKTFAWDLOGRTMA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |