C18H22N8O — CID 91818651
[4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone (PubChem CID 91818651) has the molecular formula C18H22N8O and a molecular weight of 366.43 g/mol. Its IUPAC name is [4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone.
| Compound Name | [4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 91818651 |
| Molecular Formula | C18H22N8O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
| SMILES | Cc1nnc2c(N3CCN(C(=O)c4n[nH]c5c4CCCC5)CC3)nccn12 |
| InChI | InChI=1S/C18H22N8O/c1-12-20-23-17-16(19-6-7-26(12)17)24-8-10-25(11-9-24)18(27)15-13-4-2-3-5-14(13)21-22-15/h6-7H,2-5,8-11H2,1H3,(H,21,22) |
| InChIKey | YGVBFTOXNFXDCQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |