C16H20Cl2N2O3S — CID 91819175
(2,3-dichlorophenyl)-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]methanone (PubChem CID 91819175) has the molecular formula C16H20Cl2N2O3S and a molecular weight of 391.32 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91819175 |
| Molecular Formula | C16H20Cl2N2O3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (2,3-dichlorophenyl)-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)N1CCN(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O3S/c17-14-3-1-2-13(15(14)18)16(21)20-8-6-19(7-9-20)12-4-10-24(22,23)11-5-12/h1-3,12H,4-11H2 |
| InChIKey | DSBTUGIEDVOFBR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |