C26H21FN4O3 — CID 91819652
(5S)-2-amino-2'-(3,6-dihydro-2H-pyran-4-yl)-7'-(2-fluoro-3-pyridinyl)-3-methylspiro[imidazole-5,9'-xanthene]-4-one (PubChem CID 91819652) has the molecular formula C26H21FN4O3 and a molecular weight of 456.48 g/mol. Its IUPAC name is (5S)-2-amino-2'-(3,6-dihydro-2H-pyran-4-yl)-7'-(2-fluoro-3-pyridinyl)-3-methylspiro[imidazole-5,9'-xanthene]-4-one.
| Compound Name | (5S)-2-amino-2'-(3,6-dihydro-2H-pyran-4-yl)-7'-(2-fluoro-3-pyridinyl)-3-methylspiro[imidazole-5,9'-xanthene]-4-one |
|---|---|
| PubChem CID | 91819652 |
| Molecular Formula | C26H21FN4O3 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (5S)-2-amino-2'-(3,6-dihydro-2H-pyran-4-yl)-7'-(2-fluoro-3-pyridinyl)-3-methylspiro[imidazole-5,9'-xanthene]-4-one |
| SMILES | CN1C(=O)[C@]2(N=C1N)c1cc(C3=CCOCC3)ccc1Oc1ccc(-c3cccnc3F)cc12 |
| InChI | InChI=1S/C26H21FN4O3/c1-31-24(32)26(30-25(31)28)19-13-16(15-8-11-33-12-9-15)4-6-21(19)34-22-7-5-17(14-20(22)26)18-3-2-10-29-23(18)27/h2-8,10,13-14H,9,11-12H2,1H3,(H2,28,30)/t26-/m0/s1 |
| InChIKey | LYJVRBNHSBJALN-SANMLTNESA-N |
| XLogP | 3.83 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|