C20H26N6O4S — CID 91819682
1-[(1S,2S)-2-cyanocyclohexyl]-3-[4-(2-methoxyethylsulfamoyl)anilino]pyrazole-4-carboxamide (PubChem CID 91819682) has the molecular formula C20H26N6O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-[(1S,2S)-2-cyanocyclohexyl]-3-[4-(2-methoxyethylsulfamoyl)anilino]pyrazole-4-carboxamide.
| Compound Name | 1-[(1S,2S)-2-cyanocyclohexyl]-3-[4-(2-methoxyethylsulfamoyl)anilino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91819682 |
| Molecular Formula | C20H26N6O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-[(1S,2S)-2-cyanocyclohexyl]-3-[4-(2-methoxyethylsulfamoyl)anilino]pyrazole-4-carboxamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Nc2nn([C@H]3CCCC[C@@H]3C#N)cc2C(N)=O)cc1 |
| InChI | InChI=1S/C20H26N6O4S/c1-30-11-10-23-31(28,29)16-8-6-15(7-9-16)24-20-17(19(22)27)13-26(25-20)18-5-3-2-4-14(18)12-21/h6-9,13-14,18,23H,2-5,10-11H2,1H3,(H2,22,27)(H,24,25)/t14-,18+/m1/s1 |
| InChIKey | WENKKZTXXFRZLW-KDOFPFPSSA-N |
| XLogP | 1.91 |
| TPSA | 152.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|