About (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid
(2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid (PubChem CID 91819835) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid |
| PubChem CID | 91819835 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid |
| SMILES | C[C@H]1C=N[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C6H9NO2/c1-4-2-5(6(8)9)7-3-4/h3-5H,2H2,1H3,(H,8,9)/t4-,5+/m1/s1 |
| InChIKey | GSYWFASSLUGNSS-UHNVWZDZSA-N |
| XLogP | 0.55 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The IUPAC name of (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid (CID 91819835) is (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid.
What is the SMILES notation for (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The canonical SMILES for (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid is C[C@H]1C=N[C@H](C(=O)O)C1.
What is the InChIKey of (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The InChIKey is GSYWFASSLUGNSS-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-2-5(6(8)9)7-3-4/h3-5H,2H2,1H3,(H,8,9)/t4-,5+/m1/s1.
What are the key properties of (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
(2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid has a molecular weight of 127.14 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 91819835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).