C22H33NO5 — CID 91819995
(4E,6E,8E,10E,12E)-N-(1,4-dihydroxybutan-2-yl)-12-(hydroxymethyl)-4,8,10-trimethyl-3-oxotetradeca-4,6,8,10,12-pentaenamide (PubChem CID 91819995) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is (4E,6E,8E,10E,12E)-N-(1,4-dihydroxybutan-2-yl)-12-(hydroxymethyl)-4,8,10-trimethyl-3-oxotetradeca-4,6,8,10,12-pentaenamide.
| Compound Name | (4E,6E,8E,10E,12E)-N-(1,4-dihydroxybutan-2-yl)-12-(hydroxymethyl)-4,8,10-trimethyl-3-oxotetradeca-4,6,8,10,12-pentaenamide |
|---|---|
| PubChem CID | 91819995 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (4E,6E,8E,10E,12E)-N-(1,4-dihydroxybutan-2-yl)-12-(hydroxymethyl)-4,8,10-trimethyl-3-oxotetradeca-4,6,8,10,12-pentaenamide |
| SMILES | C/C=C(\C=C(C)\C=C(C)\C=C\C=C(/C)C(=O)CC(=O)NC(CO)CCO)CO |
| InChI | InChI=1S/C22H33NO5/c1-5-19(14-25)12-17(3)11-16(2)7-6-8-18(4)21(27)13-22(28)23-20(15-26)9-10-24/h5-8,11-12,20,24-26H,9-10,13-15H2,1-4H3,(H,23,28)/b7-6+,16-11+,17-12+,18-8+,19-5+ |
| InChIKey | XAQPTFWOZFYBOH-NXHKTFJCSA-N |
| XLogP | 2.14 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|