C19H15NO9 — CID 91820098
(4aR,12aR)-1,4a,8,10,11,12a-hexahydroxy-3,12-dioxo-4,5-dihydrotetracene-2-carboxamide (PubChem CID 91820098) has the molecular formula C19H15NO9 and a molecular weight of 401.33 g/mol. Its IUPAC name is (4aR,12aR)-1,4a,8,10,11,12a-hexahydroxy-3,12-dioxo-4,5-dihydrotetracene-2-carboxamide.
| Compound Name | (4aR,12aR)-1,4a,8,10,11,12a-hexahydroxy-3,12-dioxo-4,5-dihydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91820098 |
| Molecular Formula | C19H15NO9 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (4aR,12aR)-1,4a,8,10,11,12a-hexahydroxy-3,12-dioxo-4,5-dihydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)c3c(cc4cc(O)cc(O)c4c3O)C[C@@]2(O)CC1=O |
| InChI | InChI=1S/C19H15NO9/c20-17(27)13-10(23)5-18(28)4-7-1-6-2-8(21)3-9(22)11(6)14(24)12(7)15(25)19(18,29)16(13)26/h1-3,21-22,24,26,28-29H,4-5H2,(H2,20,27)/t18-,19+/m1/s1 |
| InChIKey | XZMHEWSQIGGCKG-MOPGFXCFSA-N |
| XLogP | -0.57 |
| TPSA | 198.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|