C11H18N2O6 — CID 91820433
(E)-5-[(4-amino-4-carboxybutyl)-hydroxyamino]-3-methyl-5-oxopent-3-enoic acid (PubChem CID 91820433) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is (E)-5-[(4-amino-4-carboxybutyl)-hydroxyamino]-3-methyl-5-oxopent-3-enoic acid.
| Compound Name | (E)-5-[(4-amino-4-carboxybutyl)-hydroxyamino]-3-methyl-5-oxopent-3-enoic acid |
|---|---|
| PubChem CID | 91820433 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (E)-5-[(4-amino-4-carboxybutyl)-hydroxyamino]-3-methyl-5-oxopent-3-enoic acid |
| SMILES | C/C(=C\C(=O)N(O)CCCC(N)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H18N2O6/c1-7(6-10(15)16)5-9(14)13(19)4-2-3-8(12)11(17)18/h5,8,19H,2-4,6,12H2,1H3,(H,15,16)(H,17,18)/b7-5+ |
| InChIKey | WKYDRCQCQXZNIH-FNORWQNLSA-N |
| XLogP | -0.18 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|