C27H19F9O4S — CID 91820649
(1R,5S)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonyl-6-oxabicyclo[3.1.0]hexane (PubChem CID 91820649) has the molecular formula C27H19F9O4S and a molecular weight of 610.49 g/mol. Its IUPAC name is (1R,5S)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonyl-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonyl-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 91820649 |
| Molecular Formula | C27H19F9O4S |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | (1R,5S)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonyl-6-oxabicyclo[3.1.0]hexane |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)C[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C27H19F9O4S/c28-17-8-10-18(11-9-17)41(37,38)24(12-22-23(13-24)40-22)15-4-6-16(7-5-15)25(26(31,32)33,27(34,35)36)39-14-19-20(29)2-1-3-21(19)30/h1-11,22-23H,12-14H2/t22-,23+,24? |
| InChIKey | WMBFBWXOEHDWRM-VSGJHWFKSA-N |
| XLogP | 6.87 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|