C31H25F9N2O4S — CID 91820652
2-cyano-N-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]acetamide (PubChem CID 91820652) has the molecular formula C31H25F9N2O4S and a molecular weight of 692.60 g/mol. Its IUPAC name is 2-cyano-N-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]acetamide.
| Compound Name | 2-cyano-N-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 91820652 |
| Molecular Formula | C31H25F9N2O4S |
| Molecular Weight | 692.60 g/mol |
| Exact Mass | 692.14 |
| IUPAC Name | 2-cyano-N-[4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonylcyclohexyl]acetamide |
| SMILES | N#CCC(=O)NC1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C31H25F9N2O4S/c32-21-8-10-23(11-9-21)47(44,45)28(15-12-22(13-16-28)42-27(43)14-17-41)19-4-6-20(7-5-19)29(30(35,36)37,31(38,39)40)46-18-24-25(33)2-1-3-26(24)34/h1-11,22H,12-16,18H2,(H,42,43) |
| InChIKey | JZECHQWYRRRXPP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |