C13H18O5S — CID 91820741
(3S,4R,5R,6S)-6-(benzylsulfanylmethyl)oxane-2,3,4,5-tetrol (PubChem CID 91820741) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is (3S,4R,5R,6S)-6-(benzylsulfanylmethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3S,4R,5R,6S)-6-(benzylsulfanylmethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 91820741 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (3S,4R,5R,6S)-6-(benzylsulfanylmethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC1O[C@H](CSCc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O5S/c14-10-9(18-13(17)12(16)11(10)15)7-19-6-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10+,11-,12+,13?/m1/s1 |
| InChIKey | QSIDUGCDMOGXOR-UCEQBCCISA-N |
| XLogP | -0.28 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |