C16H16F3N5OS — CID 91821485
5-[(4-methylpiperazin-1-yl)-(3,4,5-trifluorophenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 91821485) has the molecular formula C16H16F3N5OS and a molecular weight of 383.40 g/mol. Its IUPAC name is 5-[(4-methylpiperazin-1-yl)-(3,4,5-trifluorophenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(4-methylpiperazin-1-yl)-(3,4,5-trifluorophenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 91821485 |
| Molecular Formula | C16H16F3N5OS |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 5-[(4-methylpiperazin-1-yl)-(3,4,5-trifluorophenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | CN1CCN(C(c2cc(F)c(F)c(F)c2)c2sc3ncnn3c2O)CC1 |
| InChI | InChI=1S/C16H16F3N5OS/c1-22-2-4-23(5-3-22)13(9-6-10(17)12(19)11(18)7-9)14-15(25)24-16(26-14)20-8-21-24/h6-8,13,25H,2-5H2,1H3 |
| InChIKey | KRQRXHYHKIWWAC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|